C25H28N4O5S — CID 10163766
methanesulfonic acid;3-[5-[(4-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one (PubChem CID 10163766) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is methanesulfonic acid;3-[5-[(4-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one.
| Compound Name | methanesulfonic acid;3-[5-[(4-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10163766 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | methanesulfonic acid;3-[5-[(4-methyl-5-oxo-1,4-diazepan-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one |
| SMILES | CN1CCN(Cc2ccc3[nH]c(-c4cc5ccccc5[nH]c4=O)cc3c2)CCC1=O.CS(=O)(=O)O |
| InChI | InChI=1S/C24H24N4O2.CH4O3S/c1-27-10-11-28(9-8-23(27)29)15-16-6-7-21-18(12-16)14-22(25-21)19-13-17-4-2-3-5-20(17)26-24(19)30;1-5(2,3)4/h2-7,12-14,25H,8-11,15H2,1H3,(H,26,30);1H3,(H,2,3,4) |
| InChIKey | GGUZPWYAFLBOKP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|