C21H23N5O — CID 142221993
1-[[2-(5-ethynyl-4-methyl-1H-pyrazol-3-yl)-1H-indol-5-yl]methyl]-4-methyl-1,4-diazepan-5-one (PubChem CID 142221993) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-[[2-(5-ethynyl-4-methyl-1H-pyrazol-3-yl)-1H-indol-5-yl]methyl]-4-methyl-1,4-diazepan-5-one.
| Compound Name | 1-[[2-(5-ethynyl-4-methyl-1H-pyrazol-3-yl)-1H-indol-5-yl]methyl]-4-methyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 142221993 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[[2-(5-ethynyl-4-methyl-1H-pyrazol-3-yl)-1H-indol-5-yl]methyl]-4-methyl-1,4-diazepan-5-one |
| SMILES | C#Cc1[nH]nc(-c2cc3cc(CN4CCC(=O)N(C)CC4)ccc3[nH]2)c1C |
| InChI | InChI=1S/C21H23N5O/c1-4-17-14(2)21(24-23-17)19-12-16-11-15(5-6-18(16)22-19)13-26-8-7-20(27)25(3)9-10-26/h1,5-6,11-12,22H,7-10,13H2,2-3H3,(H,23,24) |
| InChIKey | WPVKFJNNPYPOHZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|