C24H29N4O2S+ — CID 142059869
methanol;3-[5-[(4-methylsulfanylpiperazin-1-ium-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one (PubChem CID 142059869) has the molecular formula C24H29N4O2S+ and a molecular weight of 437.59 g/mol. Its IUPAC name is methanol;3-[5-[(4-methylsulfanylpiperazin-1-ium-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one.
| Compound Name | methanol;3-[5-[(4-methylsulfanylpiperazin-1-ium-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142059869 |
| Molecular Formula | C24H29N4O2S+ |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | methanol;3-[5-[(4-methylsulfanylpiperazin-1-ium-1-yl)methyl]-1H-indol-2-yl]-1H-quinolin-2-one |
| SMILES | CO.CSN1CC[NH+](Cc2ccc3[nH]c(-c4cc5ccccc5[nH]c4=O)cc3c2)CC1 |
| InChI | InChI=1S/C23H24N4OS.CH4O/c1-29-27-10-8-26(9-11-27)15-16-6-7-21-18(12-16)14-22(24-21)19-13-17-4-2-3-5-20(17)25-23(19)28;1-2/h2-7,12-14,24H,8-11,15H2,1H3,(H,25,28);2H,1H3/p+1 |
| InChIKey | SJVWJXWTARBEFD-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|