About 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide
3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 144618606) has the molecular formula C17H14F2N4O
and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide |
| PubChem CID | 144618606 |
| Molecular Formula | C17H14F2N4O |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(N)n[nH]c1-c1ccc(Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H14F2N4O/c18-12-6-5-11(13(19)8-12)7-9-1-3-10(4-2-9)15-14(17(21)24)16(20)23-22-15/h1-6,8H,7H2,(H2,21,24)(H3,20,22,23) |
| InChIKey | HCYOFFXCZKHBIH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide?
The IUPAC name of 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide (CID 144618606) is 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide?
The canonical SMILES for 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide is NC(=O)c1c(N)n[nH]c1-c1ccc(Cc2ccc(F)cc2F)cc1.
What is the InChIKey of 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide?
The InChIKey is HCYOFFXCZKHBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N4O/c18-12-6-5-11(13(19)8-12)7-9-1-3-10(4-2-9)15-14(17(21)24)16(20)23-22-15/h1-6,8H,7H2,(H2,21,24)(H3,20,22,23).
What are the key properties of 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide?
3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide has a molecular weight of 328.32 g/mol, XLogP of 2.63, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-[4-[(2,4-difluorophenyl)methyl]phenyl]-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 144618606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).