C16H12FN5O — CID 175274182
4-fluoro-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]benzamide (PubChem CID 175274182) has the molecular formula C16H12FN5O and a molecular weight of 309.30 g/mol. Its IUPAC name is 4-fluoro-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]benzamide.
| Compound Name | 4-fluoro-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 175274182 |
| Molecular Formula | C16H12FN5O |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-fluoro-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(F)cc1Cc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C16H12FN5O/c17-13-5-6-14(15(18)23)12(8-13)7-10-1-3-11(4-2-10)16-21-19-9-20-22-16/h1-6,8-9H,7H2,(H2,18,23) |
| InChIKey | MBJVOBOQMZYXIL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |