C16H12FN3O2 — CID 70102797
[3-amino-5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-hydroxyphenyl)methanone (PubChem CID 70102797) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is [3-amino-5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-hydroxyphenyl)methanone.
| Compound Name | [3-amino-5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 70102797 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [3-amino-5-(4-fluorophenyl)-1H-pyrazol-4-yl]-(3-hydroxyphenyl)methanone |
| SMILES | Nc1n[nH]c(-c2ccc(F)cc2)c1C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H12FN3O2/c17-11-6-4-9(5-7-11)14-13(16(18)20-19-14)15(22)10-2-1-3-12(21)8-10/h1-8,21H,(H3,18,19,20) |
| InChIKey | KOXHKEDWBBYKKR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |