C11H8F2N2O2 — CID 118471832
2-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 118471832) has the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118471832 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(Cc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C11H8F2N2O2/c12-7-2-1-6(8(13)4-7)3-10-15-9(5-17-10)11(14)16/h1-2,4-5H,3H2,(H2,14,16) |
| InChIKey | CMWUWUIDGWLXST-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |