C18H14ClFN4O2 — CID 158239078
5-[(3-chloro-4-fluorophenyl)methyl]-3-[(4-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 158239078) has the molecular formula C18H14ClFN4O2 and a molecular weight of 372.79 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)methyl]-3-[(4-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)methyl]-3-[(4-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158239078 |
| Molecular Formula | C18H14ClFN4O2 |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)methyl]-3-[(4-hydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(/N=C/c2ccc(O)cc2)n[nH]c1Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN4O2/c19-13-7-11(3-6-14(13)20)8-15-16(17(21)26)18(24-23-15)22-9-10-1-4-12(25)5-2-10/h1-7,9,25H,8H2,(H2,21,26)(H,23,24)/b22-9+ |
| InChIKey | GFIBJYDCLJIHAZ-LSFURLLWSA-N |
| XLogP | 3.35 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|