C18H15ClN4O3 — CID 147153380
5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 147153380) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 147153380 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-3-[(2,5-dihydroxyphenyl)methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(/N=C/c2cc(O)ccc2O)n[nH]c1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN4O3/c19-12-3-1-2-10(6-12)7-14-16(17(20)26)18(23-22-14)21-9-11-8-13(24)4-5-15(11)25/h1-6,8-9,24-25H,7H2,(H2,20,26)(H,22,23)/b21-9+ |
| InChIKey | BUKNVMQEUDJCIY-ZVBGSRNCSA-N |
| XLogP | 2.91 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|