C14H9Cl2F2NO — CID 105412077
1-(4-amino-3,5-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone (PubChem CID 105412077) has the molecular formula C14H9Cl2F2NO and a molecular weight of 316.13 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 105412077 |
| Molecular Formula | C14H9Cl2F2NO |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone |
| SMILES | Nc1c(Cl)cc(C(=O)Cc2cc(F)cc(F)c2)cc1Cl |
| InChI | InChI=1S/C14H9Cl2F2NO/c15-11-4-8(5-12(16)14(11)19)13(20)3-7-1-9(17)6-10(18)2-7/h1-2,4-6H,3,19H2 |
| InChIKey | VUVNCALGSVWCIE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|