C14H10Cl2FNO — CID 116609736
1-(4-amino-3,5-dichlorophenyl)-2-(3-fluorophenyl)ethanone (PubChem CID 116609736) has the molecular formula C14H10Cl2FNO and a molecular weight of 298.14 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116609736 |
| Molecular Formula | C14H10Cl2FNO |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(3-fluorophenyl)ethanone |
| SMILES | Nc1c(Cl)cc(C(=O)Cc2cccc(F)c2)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FNO/c15-11-6-9(7-12(16)14(11)18)13(19)5-8-2-1-3-10(17)4-8/h1-4,6-7H,5,18H2 |
| InChIKey | PATMELKPRXZLTH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|