C14H9Cl3FNO — CID 103052464
1-(4-amino-3,5-dichlorophenyl)-2-(5-chloro-2-fluorophenyl)ethanone (PubChem CID 103052464) has the molecular formula C14H9Cl3FNO and a molecular weight of 332.59 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(5-chloro-2-fluorophenyl)ethanone.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(5-chloro-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 103052464 |
| Molecular Formula | C14H9Cl3FNO |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(5-chloro-2-fluorophenyl)ethanone |
| SMILES | Nc1c(Cl)cc(C(=O)Cc2cc(Cl)ccc2F)cc1Cl |
| InChI | InChI=1S/C14H9Cl3FNO/c15-9-1-2-12(18)7(3-9)6-13(20)8-4-10(16)14(19)11(17)5-8/h1-5H,6,19H2 |
| InChIKey | PFLCAJICIXUNBM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|