C11H8Cl2N2OS — CID 116609810
1-(4-amino-3,5-dichlorophenyl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 116609810) has the molecular formula C11H8Cl2N2OS and a molecular weight of 287.17 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 116609810 |
| Molecular Formula | C11H8Cl2N2OS |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | Nc1c(Cl)cc(C(=O)Cc2nccs2)cc1Cl |
| InChI | InChI=1S/C11H8Cl2N2OS/c12-7-3-6(4-8(13)11(7)14)9(16)5-10-15-1-2-17-10/h1-4H,5,14H2 |
| InChIKey | QZNOOVSTKBRPKT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|