C10H9N3OS — CID 116613745
1-(3-amino-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 116613745) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 1-(3-amino-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(3-amino-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 116613745 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-(3-amino-2-pyridinyl)-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | Nc1cccnc1C(=O)Cc1nccs1 |
| InChI | InChI=1S/C10H9N3OS/c11-7-2-1-3-13-10(7)8(14)6-9-12-4-5-15-9/h1-5H,6,11H2 |
| InChIKey | JVQUDCPWTQAZGW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |