C11H7ClFNOS — CID 112731600
1-(4-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 112731600) has the molecular formula C11H7ClFNOS and a molecular weight of 255.70 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 112731600 |
| Molecular Formula | C11H7ClFNOS |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nccs1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H7ClFNOS/c12-7-1-2-8(9(13)5-7)10(15)6-11-14-3-4-16-11/h1-5H,6H2 |
| InChIKey | UEPDNCXHDNTPAT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |