C13H12Cl2N2OS — CID 110715983
3,4-dichloro-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 110715983) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 3,4-dichloro-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110715983 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3,4-dichloro-N-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | CN(CCc1nccs1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-17(6-4-12-16-5-7-19-12)13(18)9-2-3-10(14)11(15)8-9/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | SLCIDKGLSVOAAF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |