C14H14Cl2N2OS — CID 82833096
4-amino-3,5-dichloro-N-methyl-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 82833096) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-methyl-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-methyl-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 82833096 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-amino-3,5-dichloro-N-methyl-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | CN(CCc1cccs1)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-18(5-4-10-3-2-6-20-10)14(19)9-7-11(15)13(17)12(16)8-9/h2-3,6-8H,4-5,17H2,1H3 |
| InChIKey | KYOAZVDTYXNFMO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|