C13H14ClN3OS — CID 79487639
6-amino-3-chloro-N-methyl-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide (PubChem CID 79487639) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 6-amino-3-chloro-N-methyl-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N-methyl-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 79487639 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 6-amino-3-chloro-N-methyl-N-(2-thiophen-2-ylethyl)pyridine-2-carboxamide |
| SMILES | CN(CCc1cccs1)C(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C13H14ClN3OS/c1-17(7-6-9-3-2-8-19-9)13(18)12-10(14)4-5-11(15)16-12/h2-5,8H,6-7H2,1H3,(H2,15,16) |
| InChIKey | KRGXIPVZEWFMCF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |