C18H19Br2NO2 — CID 26019445
3,5-dibromo-N-[4-[(2R)-butan-2-yl]phenyl]-2-methoxybenzamide (PubChem CID 26019445) has the molecular formula C18H19Br2NO2 and a molecular weight of 441.16 g/mol. Its IUPAC name is 3,5-dibromo-N-[4-[(2R)-butan-2-yl]phenyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[4-[(2R)-butan-2-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 26019445 |
| Molecular Formula | C18H19Br2NO2 |
| Molecular Weight | 441.16 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 3,5-dibromo-N-[4-[(2R)-butan-2-yl]phenyl]-2-methoxybenzamide |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)c2cc(Br)cc(Br)c2OC)cc1 |
| InChI | InChI=1S/C18H19Br2NO2/c1-4-11(2)12-5-7-14(8-6-12)21-18(22)15-9-13(19)10-16(20)17(15)23-3/h5-11H,4H2,1-3H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | TYVJNTXKTAFYKP-LLVKDONJSA-N |
| XLogP | 5.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.16 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |