C16H18N2O5S2 — CID 25185569
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 25185569) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 25185569 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-16(2,3)14(20)23-11-8-6-5-7-10(11)13(19)18-15-17-9-12(24-15)25(4,21)22/h5-9H,1-4H3,(H,17,18,19) |
| InChIKey | JGIFUUDJNPDTTL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|