C18H16N4O5S2 — CID 56970918
propan-2-yl [2-[(5-pyrimidin-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate (PubChem CID 56970918) has the molecular formula C18H16N4O5S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is propan-2-yl [2-[(5-pyrimidin-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate.
| Compound Name | propan-2-yl [2-[(5-pyrimidin-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 56970918 |
| Molecular Formula | C18H16N4O5S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | propan-2-yl [2-[(5-pyrimidin-2-ylsulfinyl-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate |
| SMILES | CC(C)OC(=O)Oc1ccccc1C(=O)Nc1ncc(S(=O)c2ncccn2)s1 |
| InChI | InChI=1S/C18H16N4O5S2/c1-11(2)26-18(24)27-13-7-4-3-6-12(13)15(23)22-16-21-10-14(28-16)29(25)17-19-8-5-9-20-17/h3-11H,1-2H3,(H,21,22,23) |
| InChIKey | NHATTZOUXUXATP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|