C13H11N3O3S — CID 168863211
3-cyclopropyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide (PubChem CID 168863211) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 3-cyclopropyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-cyclopropyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 168863211 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3-cyclopropyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C13H11N3O3S/c17-12(15-13-14-7-11(20-13)16(18)19)10-3-1-2-9(6-10)8-4-5-8/h1-3,6-8H,4-5H2,(H,14,15,17) |
| InChIKey | IAMANPDWXGBFNY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|