C14H12N6O5S — CID 72725188
methyl N-[1-methyl-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]benzimidazol-2-yl]carbamate (PubChem CID 72725188) has the molecular formula C14H12N6O5S and a molecular weight of 376.35 g/mol. Its IUPAC name is methyl N-[1-methyl-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[1-methyl-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 72725188 |
| Molecular Formula | C14H12N6O5S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | methyl N-[1-methyl-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(C(=O)Nc3ncc([N+](=O)[O-])s3)cc2n1C |
| InChI | InChI=1S/C14H12N6O5S/c1-19-9-5-7(3-4-8(9)16-12(19)18-14(22)25-2)11(21)17-13-15-6-10(26-13)20(23)24/h3-6H,1-2H3,(H,15,17,21)(H,16,18,22) |
| InChIKey | IWISIUKBRZCUAG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|