C17H15Cl2N5OS — CID 4546011
2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 4546011) has the molecular formula C17H15Cl2N5OS and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4546011 |
| Molecular Formula | C17H15Cl2N5OS |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccc(Cl)cc2Cl)nnc1-c1cccc(N)c1 |
| InChI | InChI=1S/C17H15Cl2N5OS/c1-24-16(10-3-2-4-12(20)7-10)22-23-17(24)26-9-15(25)21-14-6-5-11(18)8-13(14)19/h2-8H,9,20H2,1H3,(H,21,25) |
| InChIKey | GKUIGNMHICZOOM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|