C17H16BrN5OS — CID 1346507
2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-bromophenyl)acetamide (PubChem CID 1346507) has the molecular formula C17H16BrN5OS and a molecular weight of 418.32 g/mol. Its IUPAC name is 2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 1346507 |
| Molecular Formula | C17H16BrN5OS |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2-[[5-(3-aminophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-bromophenyl)acetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccc(Br)cc2)nnc1-c1cccc(N)c1 |
| InChI | InChI=1S/C17H16BrN5OS/c1-23-16(11-3-2-4-13(19)9-11)21-22-17(23)25-10-15(24)20-14-7-5-12(18)6-8-14/h2-9H,10,19H2,1H3,(H,20,24) |
| InChIKey | BOIYKKFNJKTMLE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|