C12H14FN5O2S — CID 62897703
N-(2-amino-4-fluorophenyl)-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 62897703) has the molecular formula C12H14FN5O2S and a molecular weight of 311.34 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 62897703 |
| Molecular Formula | C12H14FN5O2S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | Cn1c(SCCC(=O)Nc2ccc(F)cc2N)n[nH]c1=O |
| InChI | InChI=1S/C12H14FN5O2S/c1-18-11(20)16-17-12(18)21-5-4-10(19)15-9-3-2-7(13)6-8(9)14/h2-3,6H,4-5,14H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | SNWOFAMAYIAAIM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|