C14H15FN4OS — CID 61383083
N-(2-amino-4-fluorophenyl)-3-(5-methylpyrimidin-2-yl)sulfanylpropanamide (PubChem CID 61383083) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-(5-methylpyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-3-(5-methylpyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 61383083 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-3-(5-methylpyrimidin-2-yl)sulfanylpropanamide |
| SMILES | Cc1cnc(SCCC(=O)Nc2ccc(F)cc2N)nc1 |
| InChI | InChI=1S/C14H15FN4OS/c1-9-7-17-14(18-8-9)21-5-4-13(20)19-12-3-2-10(15)6-11(12)16/h2-3,6-8H,4-5,16H2,1H3,(H,19,20) |
| InChIKey | CPPBNTNEUYCURB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|