C14H15FN4O2 — CID 63205828
N-(2-amino-4-fluorophenyl)-3-(5-methyl-2-oxopyrimidin-1-yl)propanamide (PubChem CID 63205828) has the molecular formula C14H15FN4O2 and a molecular weight of 290.30 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-(5-methyl-2-oxopyrimidin-1-yl)propanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-3-(5-methyl-2-oxopyrimidin-1-yl)propanamide |
|---|---|
| PubChem CID | 63205828 |
| Molecular Formula | C14H15FN4O2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-3-(5-methyl-2-oxopyrimidin-1-yl)propanamide |
| SMILES | Cc1cnc(=O)n(CCC(=O)Nc2ccc(F)cc2N)c1 |
| InChI | InChI=1S/C14H15FN4O2/c1-9-7-17-14(21)19(8-9)5-4-13(20)18-12-3-2-10(15)6-11(12)16/h2-3,6-8H,4-5,16H2,1H3,(H,18,20) |
| InChIKey | ZQVRWEOVSUONQD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|