C14H16ClN3S — CID 62581906
3-chloro-N-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethyl]aniline (PubChem CID 62581906) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 3-chloro-N-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethyl]aniline.
| Compound Name | 3-chloro-N-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethyl]aniline |
|---|---|
| PubChem CID | 62581906 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-chloro-N-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylethyl]aniline |
| SMILES | Cc1cc(C)nc(SCCNc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H16ClN3S/c1-10-8-11(2)18-14(17-10)19-7-6-16-13-5-3-4-12(15)9-13/h3-5,8-9,16H,6-7H2,1-2H3 |
| InChIKey | OOBBSJXPSVDNFP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|