C10H8F4N4 — CID 107644270
2,3,5,6-tetrafluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline (PubChem CID 107644270) has the molecular formula C10H8F4N4 and a molecular weight of 260.19 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 107644270 |
| Molecular Formula | C10H8F4N4 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]aniline |
| SMILES | Cn1ncnc1CNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H8F4N4/c1-18-7(16-4-17-18)3-15-10-8(13)5(11)2-6(12)9(10)14/h2,4,15H,3H2,1H3 |
| InChIKey | JIKVQLOBLKPYGU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|