C7H12N6O4S — CID 80905959
2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanesulfonamide (PubChem CID 80905959) has the molecular formula C7H12N6O4S and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanesulfonamide.
| Compound Name | 2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 80905959 |
| Molecular Formula | C7H12N6O4S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanesulfonamide |
| SMILES | NNc1ccc([N+](=O)[O-])c(NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C7H12N6O4S/c8-12-6-2-1-5(13(14)15)7(11-6)10-3-4-18(9,16)17/h1-2H,3-4,8H2,(H2,9,16,17)(H2,10,11,12) |
| InChIKey | BRUWUJHIMIIAPH-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|