C9H12N4O6S — CID 114403662
methyl 5-nitro-6-(2-sulfamoylethylamino)pyridine-2-carboxylate (PubChem CID 114403662) has the molecular formula C9H12N4O6S and a molecular weight of 304.28 g/mol. Its IUPAC name is methyl 5-nitro-6-(2-sulfamoylethylamino)pyridine-2-carboxylate.
| Compound Name | methyl 5-nitro-6-(2-sulfamoylethylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114403662 |
| Molecular Formula | C9H12N4O6S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | methyl 5-nitro-6-(2-sulfamoylethylamino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C9H12N4O6S/c1-19-9(14)6-2-3-7(13(15)16)8(12-6)11-4-5-20(10,17)18/h2-3H,4-5H2,1H3,(H,11,12)(H2,10,17,18) |
| InChIKey | HWLHQXNUGVAFDE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|