C11H14N4O5 — CID 114404683
methyl 6-[(4-amino-4-oxobutan-2-yl)amino]-5-nitropyridine-2-carboxylate (PubChem CID 114404683) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 6-[(4-amino-4-oxobutan-2-yl)amino]-5-nitropyridine-2-carboxylate.
| Compound Name | methyl 6-[(4-amino-4-oxobutan-2-yl)amino]-5-nitropyridine-2-carboxylate |
|---|---|
| PubChem CID | 114404683 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 6-[(4-amino-4-oxobutan-2-yl)amino]-5-nitropyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(NC(C)CC(N)=O)n1 |
| InChI | InChI=1S/C11H14N4O5/c1-6(5-9(12)16)13-10-8(15(18)19)4-3-7(14-10)11(17)20-2/h3-4,6H,5H2,1-2H3,(H2,12,16)(H,13,14) |
| InChIKey | CJUQNXHKYTVHAA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|