C11H12BrN5O2S — CID 114140159
N-[2-(5-bromothiophen-2-yl)ethyl]-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 114140159) has the molecular formula C11H12BrN5O2S and a molecular weight of 358.22 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 114140159 |
| Molecular Formula | C11H12BrN5O2S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | NNc1ccc([N+](=O)[O-])c(NCCc2ccc(Br)s2)n1 |
| InChI | InChI=1S/C11H12BrN5O2S/c12-9-3-1-7(20-9)5-6-14-11-8(17(18)19)2-4-10(15-11)16-13/h1-4H,5-6,13H2,(H2,14,15,16) |
| InChIKey | CANBACRKQFADKB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|