C9H11F3N6O — CID 114157150
4-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]pyrrolidin-2-one (PubChem CID 114157150) has the molecular formula C9H11F3N6O and a molecular weight of 276.22 g/mol. Its IUPAC name is 4-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]pyrrolidin-2-one.
| Compound Name | 4-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 114157150 |
| Molecular Formula | C9H11F3N6O |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]amino]pyrrolidin-2-one |
| SMILES | NNc1cc(NC2CNC(=O)C2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N6O/c10-9(11,12)8-16-5(2-6(17-8)18-13)15-4-1-7(19)14-3-4/h2,4H,1,3,13H2,(H,14,19)(H2,15,16,17,18) |
| InChIKey | IEELFNAPTJMAHC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|