C10H11ClFN3O — CID 106183056
4-(2-amino-5-chloro-4-fluoroanilino)pyrrolidin-2-one (PubChem CID 106183056) has the molecular formula C10H11ClFN3O and a molecular weight of 243.67 g/mol. Its IUPAC name is 4-(2-amino-5-chloro-4-fluoroanilino)pyrrolidin-2-one.
| Compound Name | 4-(2-amino-5-chloro-4-fluoroanilino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 106183056 |
| Molecular Formula | C10H11ClFN3O |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-(2-amino-5-chloro-4-fluoroanilino)pyrrolidin-2-one |
| SMILES | Nc1cc(F)c(Cl)cc1NC1CNC(=O)C1 |
| InChI | InChI=1S/C10H11ClFN3O/c11-6-2-9(8(13)3-7(6)12)15-5-1-10(16)14-4-5/h2-3,5,15H,1,4,13H2,(H,14,16) |
| InChIKey | LXPQUZYGOCVRSF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|