C15H21N3O2 — CID 106535297
N-(3-piperidin-4-yloxypropyl)furo[3,2-c]pyridin-4-amine (PubChem CID 106535297) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(3-piperidin-4-yloxypropyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-piperidin-4-yloxypropyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106535297 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-(3-piperidin-4-yloxypropyl)furo[3,2-c]pyridin-4-amine |
| SMILES | c1cc2occc2c(NCCCOC2CCNCC2)n1 |
| InChI | InChI=1S/C15H21N3O2/c1(10-19-12-2-7-16-8-3-12)6-17-15-13-5-11-20-14(13)4-9-18-15/h4-5,9,11-12,16H,1-3,6-8,10H2,(H,17,18) |
| InChIKey | JKRCDOGRTNHJFP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|