C12H16N2O2 — CID 103702457
N-(3-ethoxypropyl)furo[3,2-c]pyridin-4-amine (PubChem CID 103702457) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(3-ethoxypropyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-ethoxypropyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103702457 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(3-ethoxypropyl)furo[3,2-c]pyridin-4-amine |
| SMILES | CCOCCCNc1nccc2occc12 |
| InChI | InChI=1S/C12H16N2O2/c1-2-15-8-3-6-13-12-10-5-9-16-11(10)4-7-14-12/h4-5,7,9H,2-3,6,8H2,1H3,(H,13,14) |
| InChIKey | XVPICLBRRMIMGG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|