C13H16N2O2 — CID 103853692
N-(2-but-3-enoxyethyl)furo[3,2-c]pyridin-4-amine (PubChem CID 103853692) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(2-but-3-enoxyethyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103853692 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(2-but-3-enoxyethyl)furo[3,2-c]pyridin-4-amine |
| SMILES | C=CCCOCCNc1nccc2occc12 |
| InChI | InChI=1S/C13H16N2O2/c1-2-3-8-16-10-7-15-13-11-5-9-17-12(11)4-6-14-13/h2,4-6,9H,1,3,7-8,10H2,(H,14,15) |
| InChIKey | NVNRVRZFFCKHFJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|