C12H16N2O — CID 106535128
N-(2-methylbutyl)furo[3,2-c]pyridin-4-amine (PubChem CID 106535128) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-(2-methylbutyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(2-methylbutyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106535128 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-(2-methylbutyl)furo[3,2-c]pyridin-4-amine |
| SMILES | CCC(C)CNc1nccc2occc12 |
| InChI | InChI=1S/C12H16N2O/c1-3-9(2)8-14-12-10-5-7-15-11(10)4-6-13-12/h4-7,9H,3,8H2,1-2H3,(H,13,14) |
| InChIKey | WLZCBBNURFYXKK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |