C13H16N2O3 — CID 106534898
2-[(furo[3,2-c]pyridin-4-ylamino)methyl]pentanoic acid (PubChem CID 106534898) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(furo[3,2-c]pyridin-4-ylamino)methyl]pentanoic acid.
| Compound Name | 2-[(furo[3,2-c]pyridin-4-ylamino)methyl]pentanoic acid |
|---|---|
| PubChem CID | 106534898 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[(furo[3,2-c]pyridin-4-ylamino)methyl]pentanoic acid |
| SMILES | CCCC(CNc1nccc2occc12)C(=O)O |
| InChI | InChI=1S/C13H16N2O3/c1-2-3-9(13(16)17)8-15-12-10-5-7-18-11(10)4-6-14-12/h4-7,9H,2-3,8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | IVVXBDDOPOPPTA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |