C13H18N2O — CID 103819957
N-(3-methylpentan-2-yl)furo[3,2-c]pyridin-4-amine (PubChem CID 103819957) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-(3-methylpentan-2-yl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-methylpentan-2-yl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103819957 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-(3-methylpentan-2-yl)furo[3,2-c]pyridin-4-amine |
| SMILES | CCC(C)C(C)Nc1nccc2occc12 |
| InChI | InChI=1S/C13H18N2O/c1-4-9(2)10(3)15-13-11-6-8-16-12(11)5-7-14-13/h5-10H,4H2,1-3H3,(H,14,15) |
| InChIKey | VRERXTHGRYRSDP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |