C13H19N3O — CID 106357602
3-N-furo[3,2-c]pyridin-4-yl-4-methylpentane-1,3-diamine (PubChem CID 106357602) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-N-furo[3,2-c]pyridin-4-yl-4-methylpentane-1,3-diamine.
| Compound Name | 3-N-furo[3,2-c]pyridin-4-yl-4-methylpentane-1,3-diamine |
|---|---|
| PubChem CID | 106357602 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-N-furo[3,2-c]pyridin-4-yl-4-methylpentane-1,3-diamine |
| SMILES | CC(C)C(CCN)Nc1nccc2occc12 |
| InChI | InChI=1S/C13H19N3O/c1-9(2)11(3-6-14)16-13-10-5-8-17-12(10)4-7-15-13/h4-5,7-9,11H,3,6,14H2,1-2H3,(H,15,16) |
| InChIKey | IQYHYOALYDVXEQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |