C19H28N4 — CID 110432349
N-cyclododecylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 110432349) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-cyclododecylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclododecylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110432349 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N-cyclododecylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | c1cnc2ncnc(NC3CCCCCCCCCCC3)c2c1 |
| InChI | InChI=1S/C19H28N4/c1-2-4-6-8-11-16(12-9-7-5-3-1)23-19-17-13-10-14-20-18(17)21-15-22-19/h10,13-16H,1-9,11-12H2,(H,20,21,22,23) |
| InChIKey | INMDCVKNXBMLOQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |