C13H17N3O — CID 106535301
N-[1-(aminomethyl)cyclopentyl]furo[3,2-c]pyridin-4-amine (PubChem CID 106535301) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]furo[3,2-c]pyridin-4-amine.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106535301 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]furo[3,2-c]pyridin-4-amine |
| SMILES | NCC1(Nc2nccc3occc23)CCCC1 |
| InChI | InChI=1S/C13H17N3O/c14-9-13(5-1-2-6-13)16-12-10-4-8-17-11(10)3-7-15-12/h3-4,7-8H,1-2,5-6,9,14H2,(H,15,16) |
| InChIKey | WIKNTFHRRFHECV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |