C14H11FN2O — CID 103702615
N-[(3-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine (PubChem CID 103702615) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103702615 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine |
| SMILES | Fc1cccc(CNc2nccc3occc23)c1 |
| InChI | InChI=1S/C14H11FN2O/c15-11-3-1-2-10(8-11)9-17-14-12-5-7-18-13(12)4-6-16-14/h1-8H,9H2,(H,16,17) |
| InChIKey | PIFODSARBIFQSO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |