C12H17N3O — CID 106535603
N-ethyl-N'-furo[3,2-c]pyridin-4-yl-N'-methylethane-1,2-diamine (PubChem CID 106535603) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N-ethyl-N'-furo[3,2-c]pyridin-4-yl-N'-methylethane-1,2-diamine.
| Compound Name | N-ethyl-N'-furo[3,2-c]pyridin-4-yl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 106535603 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-ethyl-N'-furo[3,2-c]pyridin-4-yl-N'-methylethane-1,2-diamine |
| SMILES | CCNCCN(C)c1nccc2occc12 |
| InChI | InChI=1S/C12H17N3O/c1-3-13-7-8-15(2)12-10-5-9-16-11(10)4-6-14-12/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey | MWHMTNJXNHYUGU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|