C14H19N3O — CID 106535287
N-propyl-N-pyrrolidin-3-ylfuro[3,2-c]pyridin-4-amine (PubChem CID 106535287) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-propyl-N-pyrrolidin-3-ylfuro[3,2-c]pyridin-4-amine.
| Compound Name | N-propyl-N-pyrrolidin-3-ylfuro[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106535287 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-propyl-N-pyrrolidin-3-ylfuro[3,2-c]pyridin-4-amine |
| SMILES | CCCN(c1nccc2occc12)C1CCNC1 |
| InChI | InChI=1S/C14H19N3O/c1-2-8-17(11-3-6-15-10-11)14-12-5-9-18-13(12)4-7-16-14/h4-5,7,9,11,15H,2-3,6,8,10H2,1H3 |
| InChIKey | RNNIPDWSTMQBRQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |