C12H18BrN3 — CID 106876124
3-bromo-N-ethyl-4-methyl-N-pyrrolidin-3-ylpyridin-2-amine (PubChem CID 106876124) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 3-bromo-N-ethyl-4-methyl-N-pyrrolidin-3-ylpyridin-2-amine.
| Compound Name | 3-bromo-N-ethyl-4-methyl-N-pyrrolidin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 106876124 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 3-bromo-N-ethyl-4-methyl-N-pyrrolidin-3-ylpyridin-2-amine |
| SMILES | CCN(c1nccc(C)c1Br)C1CCNC1 |
| InChI | InChI=1S/C12H18BrN3/c1-3-16(10-5-6-14-8-10)12-11(13)9(2)4-7-15-12/h4,7,10,14H,3,5-6,8H2,1-2H3 |
| InChIKey | XUQQZNKFZKIAGZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |