C14H20N4 — CID 62593023
N'-methyl-N-propyl-N'-quinazolin-4-ylethane-1,2-diamine (PubChem CID 62593023) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-methyl-N-propyl-N'-quinazolin-4-ylethane-1,2-diamine.
| Compound Name | N'-methyl-N-propyl-N'-quinazolin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62593023 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N'-methyl-N-propyl-N'-quinazolin-4-ylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1ncnc2ccccc12 |
| InChI | InChI=1S/C14H20N4/c1-3-8-15-9-10-18(2)14-12-6-4-5-7-13(12)16-11-17-14/h4-7,11,15H,3,8-10H2,1-2H3 |
| InChIKey | NPRVCRMSWSOGFH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|